C24H25F3O — CID 58140691
1-[2-[4-[4-(ethoxymethyl)-2-fluorophenyl]cyclohexyl]ethynyl]-2,3-difluoro-4-methylbenzene (PubChem CID 58140691) has the molecular formula C24H25F3O and a molecular weight of 386.46 g/mol. Its IUPAC name is 1-[2-[4-[4-(ethoxymethyl)-2-fluorophenyl]cyclohexyl]ethynyl]-2,3-difluoro-4-methylbenzene.
| Compound Name | 1-[2-[4-[4-(ethoxymethyl)-2-fluorophenyl]cyclohexyl]ethynyl]-2,3-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 58140691 |
| Molecular Formula | C24H25F3O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 1-[2-[4-[4-(ethoxymethyl)-2-fluorophenyl]cyclohexyl]ethynyl]-2,3-difluoro-4-methylbenzene |
| SMILES | CCOCc1ccc(C2CCC(C#Cc3ccc(C)c(F)c3F)CC2)c(F)c1 |
| InChI | InChI=1S/C24H25F3O/c1-3-28-15-18-8-13-21(22(25)14-18)19-10-5-17(6-11-19)7-12-20-9-4-16(2)23(26)24(20)27/h4,8-9,13-14,17,19H,3,5-6,10-11,15H2,1-2H3 |
| InChIKey | JBEFMVOGCOCSCC-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|