C25H23F5 — CID 130261573
1-[2-[4-(4-but-3-enyl-2-fluorophenyl)-3,3-difluorocyclohexyl]ethynyl]-2,3-difluoro-4-methylbenzene (PubChem CID 130261573) has the molecular formula C25H23F5 and a molecular weight of 418.45 g/mol. Its IUPAC name is 1-[2-[4-(4-but-3-enyl-2-fluorophenyl)-3,3-difluorocyclohexyl]ethynyl]-2,3-difluoro-4-methylbenzene.
| Compound Name | 1-[2-[4-(4-but-3-enyl-2-fluorophenyl)-3,3-difluorocyclohexyl]ethynyl]-2,3-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 130261573 |
| Molecular Formula | C25H23F5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 1-[2-[4-(4-but-3-enyl-2-fluorophenyl)-3,3-difluorocyclohexyl]ethynyl]-2,3-difluoro-4-methylbenzene |
| SMILES | C=CCCc1ccc(C2CCC(C#Cc3ccc(C)c(F)c3F)CC2(F)F)c(F)c1 |
| InChI | InChI=1S/C25H23F5/c1-3-4-5-17-8-12-20(22(26)14-17)21-13-9-18(15-25(21,29)30)7-11-19-10-6-16(2)23(27)24(19)28/h3,6,8,10,12,14,18,21H,1,4-5,9,13,15H2,2H3 |
| InChIKey | BSRNTMSELREKND-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|