C33H37F3 — CID 139867894
2-[4-[2-(4-but-3-enyl-2-fluorophenyl)ethynyl]-2,3-difluorophenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139867894) has the molecular formula C33H37F3 and a molecular weight of 490.65 g/mol. Its IUPAC name is 2-[4-[2-(4-but-3-enyl-2-fluorophenyl)ethynyl]-2,3-difluorophenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[4-[2-(4-but-3-enyl-2-fluorophenyl)ethynyl]-2,3-difluorophenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139867894 |
| Molecular Formula | C33H37F3 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 2-[4-[2-(4-but-3-enyl-2-fluorophenyl)ethynyl]-2,3-difluorophenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CCCc1ccc(C#Cc2ccc(C3CCC4CC(CC/C=C/C)CCC4C3)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C33H37F3/c1-3-5-7-9-23-11-13-28-22-29(17-16-27(28)20-23)30-19-18-26(32(35)33(30)36)15-14-25-12-10-24(8-6-4-2)21-31(25)34/h3-5,10,12,18-19,21,23,27-29H,2,6-9,11,13,16-17,20,22H2,1H3/b5-3+ |
| InChIKey | YQGAJNDZEBJLDS-HWKANZROSA-N |
| XLogP | 9.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|