C32H37FO — CID 139867265
2-[4-[2-(2-fluoro-4-prop-2-enoxyphenyl)ethynyl]phenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139867265) has the molecular formula C32H37FO and a molecular weight of 456.65 g/mol. Its IUPAC name is 2-[4-[2-(2-fluoro-4-prop-2-enoxyphenyl)ethynyl]phenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[4-[2-(2-fluoro-4-prop-2-enoxyphenyl)ethynyl]phenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139867265 |
| Molecular Formula | C32H37FO |
| Molecular Weight | 456.65 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | 2-[4-[2-(2-fluoro-4-prop-2-enoxyphenyl)ethynyl]phenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CCOc1ccc(C#Cc2ccc(C3CCC4CC(CC/C=C/C)CCC4C3)cc2)c(F)c1 |
| InChI | InChI=1S/C32H37FO/c1-3-5-6-7-25-11-15-30-22-29(17-16-28(30)21-25)26-12-8-24(9-13-26)10-14-27-18-19-31(23-32(27)33)34-20-4-2/h3-5,8-9,12-13,18-19,23,25,28-30H,2,6-7,11,15-17,20-22H2,1H3/b5-3+ |
| InChIKey | LKQMCCZVDFQAJA-HWKANZROSA-N |
| XLogP | 8.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.65 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|