C33H39FO — CID 139866440
2-[4-[2-[4-[(E)-but-2-enoxy]-3-fluorophenyl]ethynyl]phenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139866440) has the molecular formula C33H39FO and a molecular weight of 470.67 g/mol. Its IUPAC name is 2-[4-[2-[4-[(E)-but-2-enoxy]-3-fluorophenyl]ethynyl]phenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[4-[2-[4-[(E)-but-2-enoxy]-3-fluorophenyl]ethynyl]phenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139866440 |
| Molecular Formula | C33H39FO |
| Molecular Weight | 470.67 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | 2-[4-[2-[4-[(E)-but-2-enoxy]-3-fluorophenyl]ethynyl]phenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C/C=C/CCC1CCC2CC(c3ccc(C#Cc4ccc(OC/C=C/C)c(F)c4)cc3)CCC2C1 |
| InChI | InChI=1S/C33H39FO/c1-3-5-7-8-26-13-17-31-24-30(19-18-29(31)22-26)28-15-11-25(12-16-28)9-10-27-14-20-33(32(34)23-27)35-21-6-4-2/h3-6,11-12,14-16,20,23,26,29-31H,7-8,13,17-19,21-22,24H2,1-2H3/b5-3+,6-4+ |
| InChIKey | SFLYXJGULZPZEC-GGWOSOGESA-N |
| XLogP | 8.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.67 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|