C32H36F2O — CID 139868568
2-[4-[2-(3,5-difluoro-4-prop-2-enoxyphenyl)ethynyl]phenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139868568) has the molecular formula C32H36F2O and a molecular weight of 474.64 g/mol. Its IUPAC name is 2-[4-[2-(3,5-difluoro-4-prop-2-enoxyphenyl)ethynyl]phenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[4-[2-(3,5-difluoro-4-prop-2-enoxyphenyl)ethynyl]phenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139868568 |
| Molecular Formula | C32H36F2O |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | 2-[4-[2-(3,5-difluoro-4-prop-2-enoxyphenyl)ethynyl]phenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CCOc1c(F)cc(C#Cc2ccc(C3CCC4CC(CC/C=C/C)CCC4C3)cc2)cc1F |
| InChI | InChI=1S/C32H36F2O/c1-3-5-6-7-24-12-15-29-22-28(17-16-27(29)19-24)26-13-10-23(11-14-26)8-9-25-20-30(33)32(31(34)21-25)35-18-4-2/h3-5,10-11,13-14,20-21,24,27-29H,2,6-7,12,15-19,22H2,1H3/b5-3+ |
| InChIKey | QTLJOKGIFNZGCO-HWKANZROSA-N |
| XLogP | 8.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|