C30H42F2O — CID 20808720
(2R,4aR,8aR)-2-[4-[4-[(E)-but-2-enoxy]-3,5-difluorophenyl]cyclohexyl]-6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20808720) has the molecular formula C30H42F2O and a molecular weight of 456.66 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-[4-[4-[(E)-but-2-enoxy]-3,5-difluorophenyl]cyclohexyl]-6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aR,8aR)-2-[4-[4-[(E)-but-2-enoxy]-3,5-difluorophenyl]cyclohexyl]-6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20808720 |
| Molecular Formula | C30H42F2O |
| Molecular Weight | 456.66 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | (2R,4aR,8aR)-2-[4-[4-[(E)-but-2-enoxy]-3,5-difluorophenyl]cyclohexyl]-6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CCCC1CC[C@@H]2C[C@H](C3CCC(c4cc(F)c(OC/C=C/C)c(F)c4)CC3)CC[C@@H]2C1 |
| InChI | InChI=1S/C30H42F2O/c1-3-5-7-21-8-9-26-18-25(15-14-24(26)17-21)22-10-12-23(13-11-22)27-19-28(31)30(29(32)20-27)33-16-6-4-2/h3-4,6,19-26H,1,5,7-18H2,2H3/b6-4+/t21?,22?,23?,24-,25-,26-/m1/s1 |
| InChIKey | RINFRDWBCNSMQE-DSTUKRODSA-N |
| XLogP | 8.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.66 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|