C29H32F2O — CID 139868887
2-but-3-enyl-6-[4-[2-(3,5-difluoro-4-methoxyphenyl)ethynyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139868887) has the molecular formula C29H32F2O and a molecular weight of 434.57 g/mol. Its IUPAC name is 2-but-3-enyl-6-[4-[2-(3,5-difluoro-4-methoxyphenyl)ethynyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-but-3-enyl-6-[4-[2-(3,5-difluoro-4-methoxyphenyl)ethynyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139868887 |
| Molecular Formula | C29H32F2O |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 2-but-3-enyl-6-[4-[2-(3,5-difluoro-4-methoxyphenyl)ethynyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CCCC1CCC2CC(c3ccc(C#Cc4cc(F)c(OC)c(F)c4)cc3)CCC2C1 |
| InChI | InChI=1S/C29H32F2O/c1-3-4-5-21-10-13-26-19-25(15-14-24(26)16-21)23-11-8-20(9-12-23)6-7-22-17-27(30)29(32-2)28(31)18-22/h3,8-9,11-12,17-18,21,24-26H,1,4-5,10,13-16,19H2,2H3 |
| InChIKey | RXFOASFYDTYSEC-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|