C29H29F5 — CID 139869402
2-but-3-enyl-6-[3,5-difluoro-4-[2-[4-(trifluoromethyl)phenyl]ethynyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139869402) has the molecular formula C29H29F5 and a molecular weight of 472.54 g/mol. Its IUPAC name is 2-but-3-enyl-6-[3,5-difluoro-4-[2-[4-(trifluoromethyl)phenyl]ethynyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-but-3-enyl-6-[3,5-difluoro-4-[2-[4-(trifluoromethyl)phenyl]ethynyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139869402 |
| Molecular Formula | C29H29F5 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 2-but-3-enyl-6-[3,5-difluoro-4-[2-[4-(trifluoromethyl)phenyl]ethynyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CCCC1CCC2CC(c3cc(F)c(C#Cc4ccc(C(F)(F)F)cc4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C29H29F5/c1-2-3-4-20-5-9-22-16-23(11-10-21(22)15-20)24-17-27(30)26(28(31)18-24)14-8-19-6-12-25(13-7-19)29(32,33)34/h2,6-7,12-13,17-18,20-23H,1,3-5,9-11,15-16H2 |
| InChIKey | MDXOTOVNTHXNSP-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|