C20H26F2 — CID 20809660
(2R,4aR,8aR)-2-but-3-enyl-6-(3,5-difluorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809660) has the molecular formula C20H26F2 and a molecular weight of 304.42 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-but-3-enyl-6-(3,5-difluorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aR,8aR)-2-but-3-enyl-6-(3,5-difluorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809660 |
| Molecular Formula | C20H26F2 |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (2R,4aR,8aR)-2-but-3-enyl-6-(3,5-difluorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CCC[C@@H]1CC[C@@H]2CC(c3cc(F)cc(F)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C20H26F2/c1-2-3-4-14-5-6-16-10-17(8-7-15(16)9-14)18-11-19(21)13-20(22)12-18/h2,11-17H,1,3-10H2/t14-,15-,16-,17?/m1/s1 |
| InChIKey | QZQQXEYRRPKIAY-HJNZIYBASA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|