C27H28F6 — CID 139869371
2-but-3-enyl-6-[3,5-difluoro-4-[3-fluoro-4-(trifluoromethyl)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139869371) has the molecular formula C27H28F6 and a molecular weight of 466.51 g/mol. Its IUPAC name is 2-but-3-enyl-6-[3,5-difluoro-4-[3-fluoro-4-(trifluoromethyl)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-but-3-enyl-6-[3,5-difluoro-4-[3-fluoro-4-(trifluoromethyl)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139869371 |
| Molecular Formula | C27H28F6 |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 2-but-3-enyl-6-[3,5-difluoro-4-[3-fluoro-4-(trifluoromethyl)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CCCC1CCC2CC(c3cc(F)c(-c4ccc(C(F)(F)F)c(F)c4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C27H28F6/c1-2-3-4-16-5-6-18-12-19(8-7-17(18)11-16)21-14-24(29)26(25(30)15-21)20-9-10-22(23(28)13-20)27(31,32)33/h2,9-10,13-19H,1,3-8,11-12H2 |
| InChIKey | YKUVKDBNRFJLTH-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|