C28H29F7 — CID 139866848
2-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-3,5-difluorophenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139866848) has the molecular formula C28H29F7 and a molecular weight of 498.53 g/mol. Its IUPAC name is 2-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-3,5-difluorophenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-3,5-difluorophenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139866848 |
| Molecular Formula | C28H29F7 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 2-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-3,5-difluorophenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C/C=C/CCC1CCC2CC(c3cc(F)c(-c4cc(F)c(C(F)(F)F)c(F)c4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C28H29F7/c1-2-3-4-5-16-6-7-18-11-19(9-8-17(18)10-16)20-12-22(29)26(23(30)13-20)21-14-24(31)27(25(32)15-21)28(33,34)35/h2-3,12-19H,4-11H2,1H3/b3-2+ |
| InChIKey | OOZPVCKLNQTOMB-NSCUHMNNSA-N |
| XLogP | 9.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|