C21H28ClF — CID 22384203
2-(4-chloro-3-fluorophenyl)-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 22384203) has the molecular formula C21H28ClF and a molecular weight of 334.91 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-(4-chloro-3-fluorophenyl)-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 22384203 |
| Molecular Formula | C21H28ClF |
| Molecular Weight | 334.91 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C/C=C/CCC1CCC2CC(c3ccc(Cl)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C21H28ClF/c1-2-3-4-5-15-6-7-17-13-18(9-8-16(17)12-15)19-10-11-20(22)21(23)14-19/h2-3,10-11,14-18H,4-9,12-13H2,1H3/b3-2+ |
| InChIKey | CHURZVTZHJMTAP-NSCUHMNNSA-N |
| XLogP | 7.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.91 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|