C22H30ClF — CID 139724795
4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1-chloro-2-fluorobenzene (PubChem CID 139724795) has the molecular formula C22H30ClF and a molecular weight of 348.93 g/mol. Its IUPAC name is 4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1-chloro-2-fluorobenzene.
| Compound Name | 4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1-chloro-2-fluorobenzene |
|---|---|
| PubChem CID | 139724795 |
| Molecular Formula | C22H30ClF |
| Molecular Weight | 348.93 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1-chloro-2-fluorobenzene |
| SMILES | C=CCCC1CCC(C2CCC(c3ccc(Cl)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C22H30ClF/c1-2-3-4-16-5-7-17(8-6-16)18-9-11-19(12-10-18)20-13-14-21(23)22(24)15-20/h2,13-19H,1,3-12H2 |
| InChIKey | LSPMTCQQHHHSIR-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.93 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|