C25H36ClF — CID 19094990
1-chloro-2-fluoro-4-[4-[2-[4-[(E)-pent-1-enyl]cyclohexyl]ethyl]cyclohexyl]benzene (PubChem CID 19094990) has the molecular formula C25H36ClF and a molecular weight of 391.01 g/mol. Its IUPAC name is 1-chloro-2-fluoro-4-[4-[2-[4-[(E)-pent-1-enyl]cyclohexyl]ethyl]cyclohexyl]benzene.
| Compound Name | 1-chloro-2-fluoro-4-[4-[2-[4-[(E)-pent-1-enyl]cyclohexyl]ethyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 19094990 |
| Molecular Formula | C25H36ClF |
| Molecular Weight | 391.01 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | 1-chloro-2-fluoro-4-[4-[2-[4-[(E)-pent-1-enyl]cyclohexyl]ethyl]cyclohexyl]benzene |
| SMILES | CCC/C=C/C1CCC(CCC2CCC(c3ccc(Cl)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C25H36ClF/c1-2-3-4-5-19-6-8-20(9-7-19)10-11-21-12-14-22(15-13-21)23-16-17-24(26)25(27)18-23/h4-5,16-22H,2-3,6-15H2,1H3/b5-4+ |
| InChIKey | JCUMQBZMYYNQMI-SNAWJCMRSA-N |
| XLogP | 8.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.01 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|