C23H32ClF — CID 67610570
2-chloro-1-fluoro-4-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]benzene (PubChem CID 67610570) has the molecular formula C23H32ClF and a molecular weight of 362.96 g/mol. Its IUPAC name is 2-chloro-1-fluoro-4-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]benzene.
| Compound Name | 2-chloro-1-fluoro-4-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 67610570 |
| Molecular Formula | C23H32ClF |
| Molecular Weight | 362.96 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 2-chloro-1-fluoro-4-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]benzene |
| SMILES | C/C=C/C1CCC(CCC2CCC(c3ccc(F)c(Cl)c3)CC2)CC1 |
| InChI | InChI=1S/C23H32ClF/c1-2-3-17-4-6-18(7-5-17)8-9-19-10-12-20(13-11-19)21-14-15-23(25)22(24)16-21/h2-3,14-20H,4-13H2,1H3/b3-2+ |
| InChIKey | GDNQFLVFKRNMOI-NSCUHMNNSA-N |
| XLogP | 7.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.96 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|