C24H31F5O — CID 67589680
1,3-difluoro-5-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]-2-(trifluoromethoxy)benzene (PubChem CID 67589680) has the molecular formula C24H31F5O and a molecular weight of 430.50 g/mol. Its IUPAC name is 1,3-difluoro-5-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]-2-(trifluoromethoxy)benzene.
| Compound Name | 1,3-difluoro-5-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 67589680 |
| Molecular Formula | C24H31F5O |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 1,3-difluoro-5-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]-2-(trifluoromethoxy)benzene |
| SMILES | C/C=C/C1CCC(CCC2CCC(c3cc(F)c(OC(F)(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C24H31F5O/c1-2-3-16-4-6-17(7-5-16)8-9-18-10-12-19(13-11-18)20-14-21(25)23(22(26)15-20)30-24(27,28)29/h2-3,14-19H,4-13H2,1H3/b3-2+ |
| InChIKey | YPAGKUGIUYFQFO-NSCUHMNNSA-N |
| XLogP | 8.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|