C17H16F8O — CID 54522431
1,3-difluoro-5-[4-(4,4,4-trifluorobut-1-enyl)cyclohexyl]-2-(trifluoromethoxy)benzene (PubChem CID 54522431) has the molecular formula C17H16F8O and a molecular weight of 388.30 g/mol. Its IUPAC name is 1,3-difluoro-5-[4-(4,4,4-trifluorobut-1-enyl)cyclohexyl]-2-(trifluoromethoxy)benzene.
| Compound Name | 1,3-difluoro-5-[4-(4,4,4-trifluorobut-1-enyl)cyclohexyl]-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 54522431 |
| Molecular Formula | C17H16F8O |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 1,3-difluoro-5-[4-(4,4,4-trifluorobut-1-enyl)cyclohexyl]-2-(trifluoromethoxy)benzene |
| SMILES | Fc1cc(C2CCC(C=CCC(F)(F)F)CC2)cc(F)c1OC(F)(F)F |
| InChI | InChI=1S/C17H16F8O/c18-13-8-12(9-14(19)15(13)26-17(23,24)25)11-5-3-10(4-6-11)2-1-7-16(20,21)22/h1-2,8-11H,3-7H2 |
| InChIKey | YQTKXHJZGJVPMT-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|