C17H18F6O — CID 54386201
5-[4-(4,4-difluorobut-1-enyl)cyclohexyl]-2-(difluoromethoxy)-1,3-difluorobenzene (PubChem CID 54386201) has the molecular formula C17H18F6O and a molecular weight of 352.32 g/mol. Its IUPAC name is 5-[4-(4,4-difluorobut-1-enyl)cyclohexyl]-2-(difluoromethoxy)-1,3-difluorobenzene.
| Compound Name | 5-[4-(4,4-difluorobut-1-enyl)cyclohexyl]-2-(difluoromethoxy)-1,3-difluorobenzene |
|---|---|
| PubChem CID | 54386201 |
| Molecular Formula | C17H18F6O |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 5-[4-(4,4-difluorobut-1-enyl)cyclohexyl]-2-(difluoromethoxy)-1,3-difluorobenzene |
| SMILES | Fc1cc(C2CCC(C=CCC(F)F)CC2)cc(F)c1OC(F)F |
| InChI | InChI=1S/C17H18F6O/c18-13-8-12(9-14(19)16(13)24-17(22)23)11-6-4-10(5-7-11)2-1-3-15(20)21/h1-2,8-11,15,17H,3-7H2 |
| InChIKey | VDKPCQKTNVGVPL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|