C16H18F4 — CID 19695568
4-[4-[(E)-4,4-difluorobut-1-enyl]cyclohexyl]-1,2-difluorobenzene (PubChem CID 19695568) has the molecular formula C16H18F4 and a molecular weight of 286.31 g/mol. Its IUPAC name is 4-[4-[(E)-4,4-difluorobut-1-enyl]cyclohexyl]-1,2-difluorobenzene.
| Compound Name | 4-[4-[(E)-4,4-difluorobut-1-enyl]cyclohexyl]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 19695568 |
| Molecular Formula | C16H18F4 |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 4-[4-[(E)-4,4-difluorobut-1-enyl]cyclohexyl]-1,2-difluorobenzene |
| SMILES | Fc1ccc(C2CCC(/C=C/CC(F)F)CC2)cc1F |
| InChI | InChI=1S/C16H18F4/c17-14-9-8-13(10-15(14)18)12-6-4-11(5-7-12)2-1-3-16(19)20/h1-2,8-12,16H,3-7H2/b2-1+ |
| InChIKey | XHVKUBKWNVWAGU-OWOJBTEDSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|