C18H22F4O — CID 18658510
2-(difluoromethoxy)-1,3-difluoro-5-(4-pent-4-enylcyclohexyl)benzene (PubChem CID 18658510) has the molecular formula C18H22F4O and a molecular weight of 330.37 g/mol. Its IUPAC name is 2-(difluoromethoxy)-1,3-difluoro-5-(4-pent-4-enylcyclohexyl)benzene.
| Compound Name | 2-(difluoromethoxy)-1,3-difluoro-5-(4-pent-4-enylcyclohexyl)benzene |
|---|---|
| PubChem CID | 18658510 |
| Molecular Formula | C18H22F4O |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-(difluoromethoxy)-1,3-difluoro-5-(4-pent-4-enylcyclohexyl)benzene |
| SMILES | C=CCCCC1CCC(c2cc(F)c(OC(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C18H22F4O/c1-2-3-4-5-12-6-8-13(9-7-12)14-10-15(19)17(16(20)11-14)23-18(21)22/h2,10-13,18H,1,3-9H2 |
| InChIKey | SPFOQNBZHTXXJR-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|