C27H38F4O — CID 139837418
2-(4-butylcyclohexyl)-6-[4-(difluoromethoxy)-3,5-difluorophenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139837418) has the molecular formula C27H38F4O and a molecular weight of 454.59 g/mol. Its IUPAC name is 2-(4-butylcyclohexyl)-6-[4-(difluoromethoxy)-3,5-difluorophenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-(4-butylcyclohexyl)-6-[4-(difluoromethoxy)-3,5-difluorophenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139837418 |
| Molecular Formula | C27H38F4O |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | 2-(4-butylcyclohexyl)-6-[4-(difluoromethoxy)-3,5-difluorophenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCC1CCC(C2CCC3CC(c4cc(F)c(OC(F)F)c(F)c4)CCC3C2)CC1 |
| InChI | InChI=1S/C27H38F4O/c1-2-3-4-17-5-7-18(8-6-17)19-9-10-21-14-22(12-11-20(21)13-19)23-15-24(28)26(25(29)16-23)32-27(30)31/h15-22,27H,2-14H2,1H3 |
| InChIKey | GKVPNOBFHVFDLP-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |