C28H38F4O3 — CID 139869272
[4-(difluoromethoxy)-3,5-difluorophenyl] 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate (PubChem CID 139869272) has the molecular formula C28H38F4O3 and a molecular weight of 498.60 g/mol. Its IUPAC name is [4-(difluoromethoxy)-3,5-difluorophenyl] 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate.
| Compound Name | [4-(difluoromethoxy)-3,5-difluorophenyl] 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139869272 |
| Molecular Formula | C28H38F4O3 |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | [4-(difluoromethoxy)-3,5-difluorophenyl] 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC2CC(C3CCC(C(=O)Oc4cc(F)c(OC(F)F)c(F)c4)CC3)CCC2C1 |
| InChI | InChI=1S/C28H38F4O3/c1-2-3-4-17-5-6-22-14-21(12-11-20(22)13-17)18-7-9-19(10-8-18)27(33)34-23-15-24(29)26(25(30)16-23)35-28(31)32/h15-22,28H,2-14H2,1H3 |
| InChIKey | FXUGTFKKCXUQCW-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|