C26H34F4O3 — CID 139869881
[4-(difluoromethoxy)-3,5-difluorophenyl] 4-(6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate (PubChem CID 139869881) has the molecular formula C26H34F4O3 and a molecular weight of 470.55 g/mol. Its IUPAC name is [4-(difluoromethoxy)-3,5-difluorophenyl] 4-(6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate.
| Compound Name | [4-(difluoromethoxy)-3,5-difluorophenyl] 4-(6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139869881 |
| Molecular Formula | C26H34F4O3 |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | [4-(difluoromethoxy)-3,5-difluorophenyl] 4-(6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
| SMILES | CCC1CCC2CC(C3CCC(C(=O)Oc4cc(F)c(OC(F)F)c(F)c4)CC3)CCC2C1 |
| InChI | InChI=1S/C26H34F4O3/c1-2-15-3-4-20-12-19(10-9-18(20)11-15)16-5-7-17(8-6-16)25(31)32-21-13-22(27)24(23(28)14-21)33-26(29)30/h13-20,26H,2-12H2,1H3 |
| InChIKey | CYNQCYNQKNTHBX-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|