C16H17F5O2 — CID 54148519
[3,5-difluoro-4-(trifluoromethyl)phenyl] 4-ethylcyclohexane-1-carboxylate (PubChem CID 54148519) has the molecular formula C16H17F5O2 and a molecular weight of 336.30 g/mol. Its IUPAC name is [3,5-difluoro-4-(trifluoromethyl)phenyl] 4-ethylcyclohexane-1-carboxylate.
| Compound Name | [3,5-difluoro-4-(trifluoromethyl)phenyl] 4-ethylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54148519 |
| Molecular Formula | C16H17F5O2 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | [3,5-difluoro-4-(trifluoromethyl)phenyl] 4-ethylcyclohexane-1-carboxylate |
| SMILES | CCC1CCC(C(=O)Oc2cc(F)c(C(F)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C16H17F5O2/c1-2-9-3-5-10(6-4-9)15(22)23-11-7-12(17)14(13(18)8-11)16(19,20)21/h7-10H,2-6H2,1H3 |
| InChIKey | OGBMIFYVOFGRGE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|