C15H18F2O2 — CID 139638411
(2,3-difluorophenyl) 4-ethylcyclohexane-1-carboxylate (PubChem CID 139638411) has the molecular formula C15H18F2O2 and a molecular weight of 268.30 g/mol. Its IUPAC name is (2,3-difluorophenyl) 4-ethylcyclohexane-1-carboxylate.
| Compound Name | (2,3-difluorophenyl) 4-ethylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139638411 |
| Molecular Formula | C15H18F2O2 |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (2,3-difluorophenyl) 4-ethylcyclohexane-1-carboxylate |
| SMILES | CCC1CCC(C(=O)Oc2cccc(F)c2F)CC1 |
| InChI | InChI=1S/C15H18F2O2/c1-2-10-6-8-11(9-7-10)15(18)19-13-5-3-4-12(16)14(13)17/h3-5,10-11H,2,6-9H2,1H3 |
| InChIKey | OUBGXJOVPXVFKX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|