C19H24F2O3 — CID 129138320
(2,3-difluorophenyl) 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate (PubChem CID 129138320) has the molecular formula C19H24F2O3 and a molecular weight of 338.39 g/mol. Its IUPAC name is (2,3-difluorophenyl) 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | (2,3-difluorophenyl) 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 129138320 |
| Molecular Formula | C19H24F2O3 |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (2,3-difluorophenyl) 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate |
| SMILES | O=C(Oc1cccc(F)c1F)C1CCC(C2CCC(O)CC2)CC1 |
| InChI | InChI=1S/C19H24F2O3/c20-16-2-1-3-17(18(16)21)24-19(23)14-6-4-12(5-7-14)13-8-10-15(22)11-9-13/h1-3,12-15,22H,4-11H2 |
| InChIKey | IFWYSJHFBOFGMX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|