About (2,3-difluorophenyl) 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate
(2,3-difluorophenyl) 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate (PubChem CID 129138320) has the molecular formula C19H24F2O3
and a molecular weight of 338.39 g/mol. Its IUPAC name is (2,3-difluorophenyl) 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (2,3-difluorophenyl) 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate |
| PubChem CID | 129138320 |
| Molecular Formula | C19H24F2O3 |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (2,3-difluorophenyl) 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate |
| SMILES | O=C(Oc1cccc(F)c1F)C1CCC(C2CCC(O)CC2)CC1 |
| InChI | InChI=1S/C19H24F2O3/c20-16-2-1-3-17(18(16)21)24-19(23)14-6-4-12(5-7-14)13-8-10-15(22)11-9-13/h1-3,12-15,22H,4-11H2 |
| InChIKey | IFWYSJHFBOFGMX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,3-difluorophenyl) 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-difluorophenyl) 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate?
The IUPAC name of (2,3-difluorophenyl) 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate (CID 129138320) is (2,3-difluorophenyl) 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate.
What is the SMILES notation for (2,3-difluorophenyl) 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate?
The canonical SMILES for (2,3-difluorophenyl) 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate is O=C(Oc1cccc(F)c1F)C1CCC(C2CCC(O)CC2)CC1.
What is the InChIKey of (2,3-difluorophenyl) 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate?
The InChIKey is IFWYSJHFBOFGMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24F2O3/c20-16-2-1-3-17(18(16)21)24-19(23)14-6-4-12(5-7-14)13-8-10-15(22)11-9-13/h1-3,12-15,22H,4-11H2.
What are the key properties of (2,3-difluorophenyl) 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate?
(2,3-difluorophenyl) 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate has a molecular weight of 338.39 g/mol, XLogP of 4.23, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-difluorophenyl) 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate is sourced from PubChem (CID 129138320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).