C14H15F2IO2 — CID 118336803
(2,3-difluoro-4-methylphenyl) 4-iodocyclohexane-1-carboxylate (PubChem CID 118336803) has the molecular formula C14H15F2IO2 and a molecular weight of 380.17 g/mol. Its IUPAC name is (2,3-difluoro-4-methylphenyl) 4-iodocyclohexane-1-carboxylate.
| Compound Name | (2,3-difluoro-4-methylphenyl) 4-iodocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118336803 |
| Molecular Formula | C14H15F2IO2 |
| Molecular Weight | 380.17 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | (2,3-difluoro-4-methylphenyl) 4-iodocyclohexane-1-carboxylate |
| SMILES | Cc1ccc(OC(=O)C2CCC(I)CC2)c(F)c1F |
| InChI | InChI=1S/C14H15F2IO2/c1-8-2-7-11(13(16)12(8)15)19-14(18)9-3-5-10(17)6-4-9/h2,7,9-10H,3-6H2,1H3 |
| InChIKey | JCLZERPFUCWCLK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.17 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|