(2,3-difluoro-4-methylphenyl) 4-iodocyclohexane-1-carboxylate

C14H15F2IO2 — CID 118336803

IUPAC(2,3-difluoro-4-methylphenyl) 4-iodocyclohexane-1-carboxylate
SMILESCc1ccc(OC(=O)C2CCC(I)CC2)c(F)c1F
InChIInChI=1S/C14H15F2IO2/c1-8-2-7-11(13(16)12(8)15)19-14(18)9-3-5-10(17)6-4-9/h2,7,9-10H,3-6H2,1H3
InChIKeyJCLZERPFUCWCLK-UHFFFAOYSA-N
MW380.17 g/mol
LogP4.17
Rot. Bonds2

About (2,3-difluoro-4-methylphenyl) 4-iodocyclohexane-1-carboxylate

(2,3-difluoro-4-methylphenyl) 4-iodocyclohexane-1-carboxylate (PubChem CID 118336803) has the molecular formula C14H15F2IO2 and a molecular weight of 380.17 g/mol. Its IUPAC name is (2,3-difluoro-4-methylphenyl) 4-iodocyclohexane-1-carboxylate.

Molecular Properties

Compound Name(2,3-difluoro-4-methylphenyl) 4-iodocyclohexane-1-carboxylate
PubChem CID118336803
Molecular FormulaC14H15F2IO2
Molecular Weight380.17 g/mol
Exact Mass380.01
IUPAC Name(2,3-difluoro-4-methylphenyl) 4-iodocyclohexane-1-carboxylate
SMILESCc1ccc(OC(=O)C2CCC(I)CC2)c(F)c1F
InChIInChI=1S/C14H15F2IO2/c1-8-2-7-11(13(16)12(8)15)19-14(18)9-3-5-10(17)6-4-9/h2,7,9-10H,3-6H2,1H3
InChIKeyJCLZERPFUCWCLK-UHFFFAOYSA-N
XLogP4.17
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500380.17
LogP ≤ 54.17
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (2,3-difluoro-4-methylphenyl) 4-iodocyclohexane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,3-difluoro-4-methylphenyl) 4-iodocyclohexane-1-carboxylate?
The IUPAC name of (2,3-difluoro-4-methylphenyl) 4-iodocyclohexane-1-carboxylate (CID 118336803) is (2,3-difluoro-4-methylphenyl) 4-iodocyclohexane-1-carboxylate.
What is the SMILES notation for (2,3-difluoro-4-methylphenyl) 4-iodocyclohexane-1-carboxylate?
The canonical SMILES for (2,3-difluoro-4-methylphenyl) 4-iodocyclohexane-1-carboxylate is Cc1ccc(OC(=O)C2CCC(I)CC2)c(F)c1F.
What is the InChIKey of (2,3-difluoro-4-methylphenyl) 4-iodocyclohexane-1-carboxylate?
The InChIKey is JCLZERPFUCWCLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F2IO2/c1-8-2-7-11(13(16)12(8)15)19-14(18)9-3-5-10(17)6-4-9/h2,7,9-10H,3-6H2,1H3.
What are the key properties of (2,3-difluoro-4-methylphenyl) 4-iodocyclohexane-1-carboxylate?
(2,3-difluoro-4-methylphenyl) 4-iodocyclohexane-1-carboxylate has a molecular weight of 380.17 g/mol, XLogP of 4.17, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-difluoro-4-methylphenyl) 4-iodocyclohexane-1-carboxylate is sourced from PubChem (CID 118336803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).