C23H30F2O2 — CID 20705670
(2,3-difluoro-4-methylphenyl) 4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane-1-carboxylate (PubChem CID 20705670) has the molecular formula C23H30F2O2 and a molecular weight of 376.49 g/mol. Its IUPAC name is (2,3-difluoro-4-methylphenyl) 4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane-1-carboxylate.
| Compound Name | (2,3-difluoro-4-methylphenyl) 4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 20705670 |
| Molecular Formula | C23H30F2O2 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (2,3-difluoro-4-methylphenyl) 4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane-1-carboxylate |
| SMILES | Cc1ccc(OC(=O)C2CCC(/C=C/C3CCC(C)CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C23H30F2O2/c1-15-3-6-17(7-4-15)8-9-18-10-12-19(13-11-18)23(26)27-20-14-5-16(2)21(24)22(20)25/h5,8-9,14-15,17-19H,3-4,6-7,10-13H2,1-2H3/b9-8+ |
| InChIKey | OIVDZXURMICETA-CMDGGOBGSA-N |
| XLogP | 6.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|