C27H36F2O2 — CID 139867462
(2,3-difluoro-4-methylphenyl) 6-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate (PubChem CID 139867462) has the molecular formula C27H36F2O2 and a molecular weight of 430.58 g/mol. Its IUPAC name is (2,3-difluoro-4-methylphenyl) 6-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate.
| Compound Name | (2,3-difluoro-4-methylphenyl) 6-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 139867462 |
| Molecular Formula | C27H36F2O2 |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | (2,3-difluoro-4-methylphenyl) 6-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
| SMILES | C/C=C/C1CCC(C2CCC3C(CCCC3C(=O)Oc3ccc(C)c(F)c3F)C2)CC1 |
| InChI | InChI=1S/C27H36F2O2/c1-3-5-18-9-11-19(12-10-18)20-13-14-22-21(16-20)6-4-7-23(22)27(30)31-24-15-8-17(2)25(28)26(24)29/h3,5,8,15,18-23H,4,6-7,9-14,16H2,1-2H3/b5-3+ |
| InChIKey | SLLLMWRFRDNRHM-HWKANZROSA-N |
| XLogP | 7.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|