C28H38F2O2 — CID 139869990
(4-but-3-enyl-2,3-difluorophenyl) 6-(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate (PubChem CID 139869990) has the molecular formula C28H38F2O2 and a molecular weight of 444.61 g/mol. Its IUPAC name is (4-but-3-enyl-2,3-difluorophenyl) 6-(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate.
| Compound Name | (4-but-3-enyl-2,3-difluorophenyl) 6-(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 139869990 |
| Molecular Formula | C28H38F2O2 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | (4-but-3-enyl-2,3-difluorophenyl) 6-(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
| SMILES | C=CCCc1ccc(OC(=O)C2CCCC3CC(C4CCC(C)CC4)CCC32)c(F)c1F |
| InChI | InChI=1S/C28H38F2O2/c1-3-4-6-20-14-16-25(27(30)26(20)29)32-28(31)24-8-5-7-22-17-21(13-15-23(22)24)19-11-9-18(2)10-12-19/h3,14,16,18-19,21-24H,1,4-13,15,17H2,2H3 |
| InChIKey | YBPMYIQRJFWAQQ-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|