C25H36O2 — CID 139869173
(4-methylphenyl) 6-(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate (PubChem CID 139869173) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is (4-methylphenyl) 6-(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate.
| Compound Name | (4-methylphenyl) 6-(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 139869173 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (4-methylphenyl) 6-(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
| SMILES | Cc1ccc(OC(=O)C2CCCC3CC(C4CCC(C)CC4)CCC32)cc1 |
| InChI | InChI=1S/C25H36O2/c1-17-6-10-19(11-7-17)20-12-15-23-21(16-20)4-3-5-24(23)25(26)27-22-13-8-18(2)9-14-22/h8-9,13-14,17,19-21,23-24H,3-7,10-12,15-16H2,1-2H3 |
| InChIKey | CJVMNRSEMFWJEV-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|