C26H35F3O2 — CID 139868362
(3,4,5-trifluorophenyl) 6-(4-propylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate (PubChem CID 139868362) has the molecular formula C26H35F3O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl) 6-(4-propylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate.
| Compound Name | (3,4,5-trifluorophenyl) 6-(4-propylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 139868362 |
| Molecular Formula | C26H35F3O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | (3,4,5-trifluorophenyl) 6-(4-propylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
| SMILES | CCCC1CCC(C2CCC3C(CCCC3C(=O)Oc3cc(F)c(F)c(F)c3)C2)CC1 |
| InChI | InChI=1S/C26H35F3O2/c1-2-4-16-7-9-17(10-8-16)18-11-12-21-19(13-18)5-3-6-22(21)26(30)31-20-14-23(27)25(29)24(28)15-20/h14-19,21-22H,2-13H2,1H3 |
| InChIKey | ZSJGHKSUMZPMDU-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|