C29H40F4O3 — CID 139867701
[4-(difluoromethoxy)-3,5-difluorophenyl] 6-(4-pentylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate (PubChem CID 139867701) has the molecular formula C29H40F4O3 and a molecular weight of 512.63 g/mol. Its IUPAC name is [4-(difluoromethoxy)-3,5-difluorophenyl] 6-(4-pentylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate.
| Compound Name | [4-(difluoromethoxy)-3,5-difluorophenyl] 6-(4-pentylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 139867701 |
| Molecular Formula | C29H40F4O3 |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | [4-(difluoromethoxy)-3,5-difluorophenyl] 6-(4-pentylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
| SMILES | CCCCCC1CCC(C2CCC3C(CCCC3C(=O)Oc3cc(F)c(OC(F)F)c(F)c3)C2)CC1 |
| InChI | InChI=1S/C29H40F4O3/c1-2-3-4-6-18-9-11-19(12-10-18)20-13-14-23-21(15-20)7-5-8-24(23)28(34)35-22-16-25(30)27(26(31)17-22)36-29(32)33/h16-21,23-24,29H,2-15H2,1H3 |
| InChIKey | JMJJOAJYPNMUAP-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|