C33H49FO2 — CID 139866194
[3-fluoro-4-[(E)-pent-3-enyl]phenyl] 6-(4-pentylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate (PubChem CID 139866194) has the molecular formula C33H49FO2 and a molecular weight of 496.75 g/mol. Its IUPAC name is [3-fluoro-4-[(E)-pent-3-enyl]phenyl] 6-(4-pentylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate.
| Compound Name | [3-fluoro-4-[(E)-pent-3-enyl]phenyl] 6-(4-pentylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 139866194 |
| Molecular Formula | C33H49FO2 |
| Molecular Weight | 496.75 g/mol |
| Exact Mass | 496.37 |
| IUPAC Name | [3-fluoro-4-[(E)-pent-3-enyl]phenyl] 6-(4-pentylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
| SMILES | C/C=C/CCc1ccc(OC(=O)C2CCCC3CC(C4CCC(CCCCC)CC4)CCC32)cc1F |
| InChI | InChI=1S/C33H49FO2/c1-3-5-7-10-24-14-16-25(17-15-24)27-19-21-30-28(22-27)12-9-13-31(30)33(35)36-29-20-18-26(32(34)23-29)11-8-6-4-2/h4,6,18,20,23-25,27-28,30-31H,3,5,7-17,19,21-22H2,1-2H3/b6-4+ |
| InChIKey | ASDMDVRYIJVTIM-GQCTYLIASA-N |
| XLogP | 9.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.75 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|