C29H40F2O3 — CID 139868199
(3,5-difluoro-4-methoxyphenyl) 6-[4-[(E)-pent-3-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate (PubChem CID 139868199) has the molecular formula C29H40F2O3 and a molecular weight of 474.63 g/mol. Its IUPAC name is (3,5-difluoro-4-methoxyphenyl) 6-[4-[(E)-pent-3-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate.
| Compound Name | (3,5-difluoro-4-methoxyphenyl) 6-[4-[(E)-pent-3-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 139868199 |
| Molecular Formula | C29H40F2O3 |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | (3,5-difluoro-4-methoxyphenyl) 6-[4-[(E)-pent-3-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
| SMILES | C/C=C/CCC1CCC(C2CCC3C(CCCC3C(=O)Oc3cc(F)c(OC)c(F)c3)C2)CC1 |
| InChI | InChI=1S/C29H40F2O3/c1-3-4-5-7-19-10-12-20(13-11-19)21-14-15-24-22(16-21)8-6-9-25(24)29(32)34-23-17-26(30)28(33-2)27(31)18-23/h3-4,17-22,24-25H,5-16H2,1-2H3/b4-3+ |
| InChIKey | VYDIZLKKRACBTR-ONEGZZNKSA-N |
| XLogP | 7.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|