C31H42F2O2 — CID 139870427
[3,5-difluoro-4-[(E)-pent-3-enyl]phenyl] 6-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate (PubChem CID 139870427) has the molecular formula C31H42F2O2 and a molecular weight of 484.67 g/mol. Its IUPAC name is [3,5-difluoro-4-[(E)-pent-3-enyl]phenyl] 6-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate.
| Compound Name | [3,5-difluoro-4-[(E)-pent-3-enyl]phenyl] 6-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 139870427 |
| Molecular Formula | C31H42F2O2 |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | [3,5-difluoro-4-[(E)-pent-3-enyl]phenyl] 6-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
| SMILES | C/C=C/CCc1c(F)cc(OC(=O)C2CCCC3CC(C4CCC(/C=C/C)CC4)CCC32)cc1F |
| InChI | InChI=1S/C31H42F2O2/c1-3-5-6-10-28-29(32)19-25(20-30(28)33)35-31(34)27-11-7-9-24-18-23(16-17-26(24)27)22-14-12-21(8-4-2)13-15-22/h3-5,8,19-24,26-27H,6-7,9-18H2,1-2H3/b5-3+,8-4+ |
| InChIKey | ODECSTVRTCUKHR-MSLMYCKWSA-N |
| XLogP | 8.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|