C27H34F4O2 — CID 139866889
[3-fluoro-4-(trifluoromethyl)phenyl] 6-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate (PubChem CID 139866889) has the molecular formula C27H34F4O2 and a molecular weight of 466.56 g/mol. Its IUPAC name is [3-fluoro-4-(trifluoromethyl)phenyl] 6-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate.
| Compound Name | [3-fluoro-4-(trifluoromethyl)phenyl] 6-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 139866889 |
| Molecular Formula | C27H34F4O2 |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | [3-fluoro-4-(trifluoromethyl)phenyl] 6-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
| SMILES | C/C=C/C1CCC(C2CCC3C(CCCC3C(=O)Oc3ccc(C(F)(F)F)c(F)c3)C2)CC1 |
| InChI | InChI=1S/C27H34F4O2/c1-2-4-17-7-9-18(10-8-17)19-11-13-22-20(15-19)5-3-6-23(22)26(32)33-21-12-14-24(25(28)16-21)27(29,30)31/h2,4,12,14,16-20,22-23H,3,5-11,13,15H2,1H3/b4-2+ |
| InChIKey | FZIYXYHRUJKRSF-DUXPYHPUSA-N |
| XLogP | 7.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|