C24H33FO2 — CID 20808114
(4-fluorophenyl) (1S,4aS,8aR)-6-(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate (PubChem CID 20808114) has the molecular formula C24H33FO2 and a molecular weight of 372.52 g/mol. Its IUPAC name is (4-fluorophenyl) (1S,4aS,8aR)-6-(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate.
| Compound Name | (4-fluorophenyl) (1S,4aS,8aR)-6-(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 20808114 |
| Molecular Formula | C24H33FO2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | (4-fluorophenyl) (1S,4aS,8aR)-6-(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
| SMILES | CC1CCC(C2CC[C@@H]3[C@@H](CCC[C@@H]3C(=O)Oc3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C24H33FO2/c1-16-5-7-17(8-6-16)18-9-14-22-19(15-18)3-2-4-23(22)24(26)27-21-12-10-20(25)11-13-21/h10-13,16-19,22-23H,2-9,14-15H2,1H3/t16?,17?,18?,19-,22+,23-/m0/s1 |
| InChIKey | UZDDTPVGBJVGKI-JHLDHFHPSA-N |
| XLogP | 6.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|