C27H37FO3 — CID 139869137
(2-fluoro-4-prop-2-enoxyphenyl) 6-(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate (PubChem CID 139869137) has the molecular formula C27H37FO3 and a molecular weight of 428.59 g/mol. Its IUPAC name is (2-fluoro-4-prop-2-enoxyphenyl) 6-(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate.
| Compound Name | (2-fluoro-4-prop-2-enoxyphenyl) 6-(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 139869137 |
| Molecular Formula | C27H37FO3 |
| Molecular Weight | 428.59 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | (2-fluoro-4-prop-2-enoxyphenyl) 6-(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
| SMILES | C=CCOc1ccc(OC(=O)C2CCCC3CC(C4CCC(C)CC4)CCC32)c(F)c1 |
| InChI | InChI=1S/C27H37FO3/c1-3-15-30-22-12-14-26(25(28)17-22)31-27(29)24-6-4-5-21-16-20(11-13-23(21)24)19-9-7-18(2)8-10-19/h3,12,14,17-21,23-24H,1,4-11,13,15-16H2,2H3 |
| InChIKey | MGLWMPPMZHALPX-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.59 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|