C32H47FO3 — CID 139866280
(2-fluoro-4-prop-2-enoxyphenyl) 6-(4-hexylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate (PubChem CID 139866280) has the molecular formula C32H47FO3 and a molecular weight of 498.72 g/mol. Its IUPAC name is (2-fluoro-4-prop-2-enoxyphenyl) 6-(4-hexylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate.
| Compound Name | (2-fluoro-4-prop-2-enoxyphenyl) 6-(4-hexylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 139866280 |
| Molecular Formula | C32H47FO3 |
| Molecular Weight | 498.72 g/mol |
| Exact Mass | 498.35 |
| IUPAC Name | (2-fluoro-4-prop-2-enoxyphenyl) 6-(4-hexylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
| SMILES | C=CCOc1ccc(OC(=O)C2CCCC3CC(C4CCC(CCCCCC)CC4)CCC32)c(F)c1 |
| InChI | InChI=1S/C32H47FO3/c1-3-5-6-7-9-23-12-14-24(15-13-23)25-16-18-28-26(21-25)10-8-11-29(28)32(34)36-31-19-17-27(22-30(31)33)35-20-4-2/h4,17,19,22-26,28-29H,2-3,5-16,18,20-21H2,1H3 |
| InChIKey | WESCIVDVGHCMMI-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.72 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|