C29H40O3 — CID 139867457
(4-prop-2-enoxyphenyl) 6-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate (PubChem CID 139867457) has the molecular formula C29H40O3 and a molecular weight of 436.64 g/mol. Its IUPAC name is (4-prop-2-enoxyphenyl) 6-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate.
| Compound Name | (4-prop-2-enoxyphenyl) 6-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 139867457 |
| Molecular Formula | C29H40O3 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | (4-prop-2-enoxyphenyl) 6-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
| SMILES | C=CCOc1ccc(OC(=O)C2CCCC3CC(C4CCC(/C=C/C)CC4)CCC32)cc1 |
| InChI | InChI=1S/C29H40O3/c1-3-6-21-9-11-22(12-10-21)23-13-18-27-24(20-23)7-5-8-28(27)29(30)32-26-16-14-25(15-17-26)31-19-4-2/h3-4,6,14-17,21-24,27-28H,2,5,7-13,18-20H2,1H3/b6-3+ |
| InChIKey | QPZVBNLRRZDCLM-ZZXKWVIFSA-N |
| XLogP | 7.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|