C26H35F3O2 — CID 139868576
[4-(trifluoromethyl)phenyl] 6-(4-ethylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate (PubChem CID 139868576) has the molecular formula C26H35F3O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl] 6-(4-ethylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate.
| Compound Name | [4-(trifluoromethyl)phenyl] 6-(4-ethylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 139868576 |
| Molecular Formula | C26H35F3O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | [4-(trifluoromethyl)phenyl] 6-(4-ethylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
| SMILES | CCC1CCC(C2CCC3C(CCCC3C(=O)Oc3ccc(C(F)(F)F)cc3)C2)CC1 |
| InChI | InChI=1S/C26H35F3O2/c1-2-17-6-8-18(9-7-17)19-10-15-23-20(16-19)4-3-5-24(23)25(30)31-22-13-11-21(12-14-22)26(27,28)29/h11-14,17-20,23-24H,2-10,15-16H2,1H3 |
| InChIKey | BFKCTPDHOYZYTA-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|