C26H31F2NO2 — CID 139870268
(4-cyano-2,3-difluorophenyl) 6-(4-ethenylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate (PubChem CID 139870268) has the molecular formula C26H31F2NO2 and a molecular weight of 427.54 g/mol. Its IUPAC name is (4-cyano-2,3-difluorophenyl) 6-(4-ethenylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate.
| Compound Name | (4-cyano-2,3-difluorophenyl) 6-(4-ethenylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 139870268 |
| Molecular Formula | C26H31F2NO2 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | (4-cyano-2,3-difluorophenyl) 6-(4-ethenylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylate |
| SMILES | C=CC1CCC(C2CCC3C(CCCC3C(=O)Oc3ccc(C#N)c(F)c3F)C2)CC1 |
| InChI | InChI=1S/C26H31F2NO2/c1-2-16-6-8-17(9-7-16)18-10-12-21-19(14-18)4-3-5-22(21)26(30)31-23-13-11-20(15-29)24(27)25(23)28/h2,11,13,16-19,21-22H,1,3-10,12,14H2 |
| InChIKey | MIRNBMJBYBPENP-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|