C30H38F6O4 — CID 122502276
[3-fluoro-4-(trifluoromethoxy)phenyl] 4-[(E)-2-[4-[difluoro-(4-methylcyclohexyl)methoxy]cyclohexyl]ethenyl]cyclohexane-1-carboxylate (PubChem CID 122502276) has the molecular formula C30H38F6O4 and a molecular weight of 576.62 g/mol. Its IUPAC name is [3-fluoro-4-(trifluoromethoxy)phenyl] 4-[(E)-2-[4-[difluoro-(4-methylcyclohexyl)methoxy]cyclohexyl]ethenyl]cyclohexane-1-carboxylate.
| Compound Name | [3-fluoro-4-(trifluoromethoxy)phenyl] 4-[(E)-2-[4-[difluoro-(4-methylcyclohexyl)methoxy]cyclohexyl]ethenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 122502276 |
| Molecular Formula | C30H38F6O4 |
| Molecular Weight | 576.62 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | [3-fluoro-4-(trifluoromethoxy)phenyl] 4-[(E)-2-[4-[difluoro-(4-methylcyclohexyl)methoxy]cyclohexyl]ethenyl]cyclohexane-1-carboxylate |
| SMILES | CC1CCC(C(F)(F)OC2CCC(/C=C/C3CCC(C(=O)Oc4ccc(OC(F)(F)F)c(F)c4)CC3)CC2)CC1 |
| InChI | InChI=1S/C30H38F6O4/c1-19-2-12-23(13-3-19)29(32,33)39-24-14-8-21(9-15-24)5-4-20-6-10-22(11-7-20)28(37)38-25-16-17-27(26(31)18-25)40-30(34,35)36/h4-5,16-24H,2-3,6-15H2,1H3/b5-4+ |
| InChIKey | YPUJIKVDTPMHJO-SNAWJCMRSA-N |
| XLogP | 8.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.62 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|