C21H18F6O3 — CID 23534753
[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl] 4-methylcyclohexane-1-carboxylate (PubChem CID 23534753) has the molecular formula C21H18F6O3 and a molecular weight of 432.36 g/mol. Its IUPAC name is [4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl] 4-methylcyclohexane-1-carboxylate.
| Compound Name | [4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl] 4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 23534753 |
| Molecular Formula | C21H18F6O3 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | [4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl] 4-methylcyclohexane-1-carboxylate |
| SMILES | CC1CCC(C(=O)Oc2ccc(C(F)(F)Oc3cc(F)c(F)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C21H18F6O3/c1-11-2-4-12(5-3-11)20(28)29-13-6-7-15(16(22)8-13)21(26,27)30-14-9-17(23)19(25)18(24)10-14/h6-12H,2-5H2,1H3 |
| InChIKey | UKXWOCYRIOHFCF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|