C15H17F3O3 — CID 20591362
[4-(difluoromethoxy)-3-fluorophenyl] 4-methylcyclohexane-1-carboxylate (PubChem CID 20591362) has the molecular formula C15H17F3O3 and a molecular weight of 302.29 g/mol. Its IUPAC name is [4-(difluoromethoxy)-3-fluorophenyl] 4-methylcyclohexane-1-carboxylate.
| Compound Name | [4-(difluoromethoxy)-3-fluorophenyl] 4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 20591362 |
| Molecular Formula | C15H17F3O3 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | [4-(difluoromethoxy)-3-fluorophenyl] 4-methylcyclohexane-1-carboxylate |
| SMILES | CC1CCC(C(=O)Oc2ccc(OC(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C15H17F3O3/c1-9-2-4-10(5-3-9)14(19)20-11-6-7-13(12(16)8-11)21-15(17)18/h6-10,15H,2-5H2,1H3 |
| InChIKey | ADSOAUFLUBSZPO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|