C15H16F4O3 — CID 20591361
[4-(difluoromethoxy)-3,5-difluorophenyl] 4-methylcyclohexane-1-carboxylate (PubChem CID 20591361) has the molecular formula C15H16F4O3 and a molecular weight of 320.28 g/mol. Its IUPAC name is [4-(difluoromethoxy)-3,5-difluorophenyl] 4-methylcyclohexane-1-carboxylate.
| Compound Name | [4-(difluoromethoxy)-3,5-difluorophenyl] 4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 20591361 |
| Molecular Formula | C15H16F4O3 |
| Molecular Weight | 320.28 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | [4-(difluoromethoxy)-3,5-difluorophenyl] 4-methylcyclohexane-1-carboxylate |
| SMILES | CC1CCC(C(=O)Oc2cc(F)c(OC(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C15H16F4O3/c1-8-2-4-9(5-3-8)14(20)21-10-6-11(16)13(12(17)7-10)22-15(18)19/h6-9,15H,2-5H2,1H3 |
| InChIKey | OJHSKKFDCKOBDA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.28 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|