C20H28F4O3Si — CID 54217420
[4-(difluoromethoxy)-3,5-difluorophenyl] 1-heptylsilinane-4-carboxylate (PubChem CID 54217420) has the molecular formula C20H28F4O3Si and a molecular weight of 420.52 g/mol. Its IUPAC name is [4-(difluoromethoxy)-3,5-difluorophenyl] 1-heptylsilinane-4-carboxylate.
| Compound Name | [4-(difluoromethoxy)-3,5-difluorophenyl] 1-heptylsilinane-4-carboxylate |
|---|---|
| PubChem CID | 54217420 |
| Molecular Formula | C20H28F4O3Si |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [4-(difluoromethoxy)-3,5-difluorophenyl] 1-heptylsilinane-4-carboxylate |
| SMILES | CCCCCCC[SiH]1CCC(C(=O)Oc2cc(F)c(OC(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C20H28F4O3Si/c1-2-3-4-5-6-9-28-10-7-14(8-11-28)19(25)26-15-12-16(21)18(17(22)13-15)27-20(23)24/h12-14,20,28H,2-11H2,1H3 |
| InChIKey | QAERTXZCIQDMMI-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|