C31H35F5OSi — CID 22867214
4-[2-[4-[4-[4-(difluoromethoxy)-3,5-difluorophenyl]phenyl]-2-fluorophenyl]ethyl]-1-pentylsilinane (PubChem CID 22867214) has the molecular formula C31H35F5OSi and a molecular weight of 546.70 g/mol. Its IUPAC name is 4-[2-[4-[4-[4-(difluoromethoxy)-3,5-difluorophenyl]phenyl]-2-fluorophenyl]ethyl]-1-pentylsilinane.
| Compound Name | 4-[2-[4-[4-[4-(difluoromethoxy)-3,5-difluorophenyl]phenyl]-2-fluorophenyl]ethyl]-1-pentylsilinane |
|---|---|
| PubChem CID | 22867214 |
| Molecular Formula | C31H35F5OSi |
| Molecular Weight | 546.70 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | 4-[2-[4-[4-[4-(difluoromethoxy)-3,5-difluorophenyl]phenyl]-2-fluorophenyl]ethyl]-1-pentylsilinane |
| SMILES | CCCCC[SiH]1CCC(CCc2ccc(-c3ccc(-c4cc(F)c(OC(F)F)c(F)c4)cc3)cc2F)CC1 |
| InChI | InChI=1S/C31H35F5OSi/c1-2-3-4-15-38-16-13-21(14-17-38)5-6-24-11-12-25(18-27(24)32)22-7-9-23(10-8-22)26-19-28(33)30(29(34)20-26)37-31(35)36/h7-12,18-21,31,38H,2-6,13-17H2,1H3 |
| InChIKey | VULLRGIMRIWFRF-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.70 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|